Products 897282-01-8
CAS 897282-01-8 appears in our catalog under these names: 3-(2,4-Dioxo-1,3-diazaspiro[4.4]non-3-yl)propanenitrile, 95%, 3-{2,4-dioxo-1,3-diazaspiro(4.4)nonan-3-yl}propanenitrile, 95%, 3-{2,4-Dioxo-1,3-diazaspiro(4.4)nonan-3-yl}propanenitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanenitrile (CAS 897282-01-8) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanenitrile. InChIKey: PGESNTIBOXIKOR-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanenitrile |
| InChIKey | PGESNTIBOXIKOR-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(=O)N(C(=O)N2)CCC#N |
Computed by PubChem (NCBI)