Products 89779-31-7
CAS 89779-31-7 is the registry number for Ethyl (2Z)-2-cyano-2-[[[(4-methylphenyl)sulfonyl]oxy]imino]acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Ethyl (2Z)-2-cyano-2-(4-methylphenyl)sulfonyloxyiminoacetate (CAS 89779-31-7) is a chemical compound with the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. IUPAC name: ethyl (2Z)-2-cyano-2-(4-methylphenyl)sulfonyloxyiminoacetate. InChIKey: VZCUEBMBHOCUAE-KAMYIIQDSA-N.
| Molecular formula | C12H12N2O5S |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | ethyl (2Z)-2-cyano-2-(4-methylphenyl)sulfonyloxyiminoacetate |
| InChIKey | VZCUEBMBHOCUAE-KAMYIIQDSA-N |
| SMILES | CCOC(=O)/C(=N\OS(=O)(=O)C1=CC=C(C=C1)C)/C#N |
Computed by PubChem (NCBI)