CAS 1934242-06-4 is the registry number for 2-Phthalimidoyl-N-(methylsulfonyl)propanamide. Offered by: Biosynth. Available pack sizes: 0,25g, 0,5g, 1g.
2-(1,3-dioxoisoindol-2-yl)-N-methylsulfonylpropanamide (CAS 1934242-06-4) is a chemical compound with the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-N-methylsulfonylpropanamide. InChIKey: CGLXOHVXHXCTQM-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5S |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-N-methylsulfonylpropanamide |
| InChIKey | CGLXOHVXHXCTQM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NS(=O)(=O)C)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)