Products 89795-76-6

CAS 89795-76-6 is the registry number for 3-Nitro-4-sulfamoylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-nitro-4-sulfamoylbenzoic acid (CAS 89795-76-6) is a chemical compound with the molecular formula C7H6N2O6S and a molecular weight of 246.20 g/mol. IUPAC name: 3-nitro-4-sulfamoylbenzoic acid. InChIKey: CVNYDIJDUSXBSC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O6S
Molecular weight246.20 g/mol
IUPAC name3-nitro-4-sulfamoylbenzoic acid
InChIKeyCVNYDIJDUSXBSC-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])S(=O)(=O)N

Computed by PubChem (NCBI)