CAS 898289-62-8 is the registry number for Methyl 2-[1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]benzoate, 90% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
Methyl 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]benzoate (CAS 898289-62-8) is a chemical compound with the molecular formula C13H11F3N2O2 and a molecular weight of 284.23 g/mol. IUPAC name: methyl 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]benzoate. InChIKey: VBXXEOGWKRJBBH-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | methyl 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]benzoate |
| InChIKey | VBXXEOGWKRJBBH-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=CC=CC=C2C(=O)OC |
Computed by PubChem (NCBI)