CAS 898391-69-0 appears in our catalog under these names: 4H,5h,6h,7h,8h,9h-cycloocta(b)thiophene-3-carboxylic acid, 95%, 4H,5H,6H,7H,8H,9H-Cycloocta(b)thiophene-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylic acid (CAS 898391-69-0) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: 4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylic acid. InChIKey: QIGYQCPBQLYULG-UHFFFAOYSA-N.
| Molecular formula | C11H14O2S |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | 4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylic acid |
| InChIKey | QIGYQCPBQLYULG-UHFFFAOYSA-N |
| SMILES | C1CCCC2=C(CC1)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)