Products 898405-47-5
CAS 898405-47-5 is the registry number for 5-Bromo-N-(1,1-dioxidotetrahydrothiophen-3-yl)-N-ethylfuran-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylfuran-2-carboxamide (CAS 898405-47-5) is a chemical compound with the molecular formula C11H14BrNO4S and a molecular weight of 336.20 g/mol. IUPAC name: 5-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylfuran-2-carboxamide. InChIKey: ZKDXNUXHQYFYDY-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO4S |
|---|---|
| Molecular weight | 336.20 g/mol |
| IUPAC name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylfuran-2-carboxamide |
| InChIKey | ZKDXNUXHQYFYDY-UHFFFAOYSA-N |
| SMILES | CCN(C1CCS(=O)(=O)C1)C(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)