Products 898527-42-9
CAS 898527-42-9 is the registry number for Fabl inhibitor 21272541. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-2-(4-chloro-2-hydroxyphenoxy)phenol (CAS 898527-42-9) is a chemical compound with the molecular formula C12H8Cl2O3 and a molecular weight of 271.09 g/mol. IUPAC name: 5-chloro-2-(4-chloro-2-hydroxyphenoxy)phenol. InChIKey: MDBKAAJLFMQWPM-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O3 |
|---|---|
| Molecular weight | 271.09 g/mol |
| IUPAC name | 5-chloro-2-(4-chloro-2-hydroxyphenoxy)phenol |
| InChIKey | MDBKAAJLFMQWPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)OC2=C(C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)
Synonyms:
Fabl inhibitor 21272541, orb2567260