CAS 898541-55-4 appears in our catalog under these names: 2-Amino-4-chloro-N,N-dimethylbenzamide, 2-Amino-4-chloro-n,n-dimethylbenzamide, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
2-amino-4-chloro-N,N-dimethylbenzamide (CAS 898541-55-4) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 2-amino-4-chloro-N,N-dimethylbenzamide. InChIKey: UPJKRJFMMWCSOH-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 2-amino-4-chloro-N,N-dimethylbenzamide |
| InChIKey | UPJKRJFMMWCSOH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)Cl)N |
Computed by PubChem (NCBI)