CAS 898785-50-7 is the registry number for 3,3-Dimethyl-1-(3-methylphenyl)-1-butanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,3-dimethyl-1-(3-methylphenyl)butan-1-one (CAS 898785-50-7) is a chemical compound with the molecular formula C13H18O and a molecular weight of 190.28 g/mol. IUPAC name: 3,3-dimethyl-1-(3-methylphenyl)butan-1-one. InChIKey: RHRHRLTXKBDIBC-UHFFFAOYSA-N.
| Molecular formula | C13H18O |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | 3,3-dimethyl-1-(3-methylphenyl)butan-1-one |
| InChIKey | RHRHRLTXKBDIBC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)CC(C)(C)C |
Computed by PubChem (NCBI)