Products 898787-59-2
CAS 898787-59-2 is the registry number for 3-(3-Bromophenyl)-1,1,1-trifluoropropan-2-one, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
3-(3-bromophenyl)-1,1,1-trifluoropropan-2-one (CAS 898787-59-2) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 3-(3-bromophenyl)-1,1,1-trifluoropropan-2-one. InChIKey: RWJVMIDCCINQDX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 3-(3-bromophenyl)-1,1,1-trifluoropropan-2-one |
| InChIKey | RWJVMIDCCINQDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)