Products 898790-30-2
CAS 898790-30-2 appears in our catalog under these names: Cyclopropyl(3,5-dichlorophenyl)methanone, Methanone, cyclopropyl(3,5-dichlorophenyl)-, 95%, 3,5-Dichlorophenyl cyclopropyl ketone, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
Cyclopropyl-(3,5-dichlorophenyl)methanone (CAS 898790-30-2) is a chemical compound with the molecular formula C10H8Cl2O and a molecular weight of 215.07 g/mol. IUPAC name: cyclopropyl-(3,5-dichlorophenyl)methanone. InChIKey: KYRDLCHKSRBJQL-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O |
|---|---|
| Molecular weight | 215.07 g/mol |
| IUPAC name | cyclopropyl-(3,5-dichlorophenyl)methanone |
| InChIKey | KYRDLCHKSRBJQL-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)