CAS 898791-54-3 appears in our catalog under these names: Cyclopentyl 3,4-Dimethylphenyl Ketone, Cyclopentyl(3,4-dimethylphenyl)methanone 97%, Cyclopentyl(3,4-dimethylphenyl)methanone, 97%, 97%, cyclopentyl 3,4-dimethylphenyl ketone, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Cyclopentyl-(3,4-dimethylphenyl)methanone (CAS 898791-54-3) is a chemical compound with the molecular formula C14H18O and a molecular weight of 202.29 g/mol. IUPAC name: cyclopentyl-(3,4-dimethylphenyl)methanone. InChIKey: AQHKHGNZZBVTMN-UHFFFAOYSA-N.
| Molecular formula | C14H18O |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | cyclopentyl-(3,4-dimethylphenyl)methanone |
| InChIKey | AQHKHGNZZBVTMN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C2CCCC2)C |
Computed by PubChem (NCBI)