CAS 899017-41-5 is the registry number for 1-(4-Aminophenyl)-3-(2,3-dichlorophenyl)prop-2-en-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-aminophenyl)-3-(2,3-dichlorophenyl)prop-2-en-1-one (CAS 899017-41-5) is a chemical compound with the molecular formula C15H11Cl2NO and a molecular weight of 292.2 g/mol. IUPAC name: 1-(4-aminophenyl)-3-(2,3-dichlorophenyl)prop-2-en-1-one. InChIKey: XWLPBVMEGRCVDG-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 1-(4-aminophenyl)-3-(2,3-dichlorophenyl)prop-2-en-1-one |
| InChIKey | XWLPBVMEGRCVDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C=CC(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)