Products 92428-57-4
CAS 92428-57-4 is the registry number for 6,9-Dichloro-2-ethoxyacridine, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
6,9-dichloro-2-ethoxyacridine (CAS 92428-57-4) is a chemical compound with the molecular formula C15H11Cl2NO and a molecular weight of 292.2 g/mol. IUPAC name: 6,9-dichloro-2-ethoxyacridine. InChIKey: LOQQMMZVYOOOSH-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 6,9-dichloro-2-ethoxyacridine |
| InChIKey | LOQQMMZVYOOOSH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)Cl)N=C2C=C1)Cl |
Computed by PubChem (NCBI)