Products 89937-94-0

CAS 89937-94-0 is the registry number for 2-((2,4-Dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)formamido)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]acetic acid (CAS 89937-94-0) is a chemical compound with the molecular formula C7H7N3O5 and a molecular weight of 213.15 g/mol. IUPAC name: 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]acetic acid. InChIKey: HNEYLBPIDFRPFM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7N3O5
Molecular weight213.15 g/mol
IUPAC name2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]acetic acid
InChIKeyHNEYLBPIDFRPFM-UHFFFAOYSA-N
SMILESC1=C(C(=O)NC(=O)N1)C(=O)NCC(=O)O

Computed by PubChem (NCBI)