CAS 89938-22-7 is the registry number for 6-Chloro-3,4-dihydroquinoxalin-2(1H)-one, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
6-chloro-3,4-dihydro-1H-quinoxalin-2-one (CAS 89938-22-7) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 6-chloro-3,4-dihydro-1H-quinoxalin-2-one. InChIKey: WXIXSRNTPHCSPF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-1H-quinoxalin-2-one |
| InChIKey | WXIXSRNTPHCSPF-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(N1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)