CAS 900015-10-3 is the registry number for 6-(4-(tert-Butyl)phenoxy)nicotinamide. Offered by: Biosynth. Available pack sizes: 10mg.
6-(4-tert-butylphenoxy)pyridine-3-carboxamide (CAS 900015-10-3) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: 6-(4-tert-butylphenoxy)pyridine-3-carboxamide. InChIKey: MMTUOOHPVFBBFP-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | 6-(4-tert-butylphenoxy)pyridine-3-carboxamide |
| InChIKey | MMTUOOHPVFBBFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC2=NC=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)