Products 90003-14-8

CAS 90003-14-8 is the registry number for 2-Chloro-5-methylcyclohex-1-ene-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-chloro-5-methylcyclohexene-1-carboxylic acid (CAS 90003-14-8) is a chemical compound with the molecular formula C8H11ClO2 and a molecular weight of 174.62 g/mol. IUPAC name: 2-chloro-5-methylcyclohexene-1-carboxylic acid. InChIKey: XXIXGILTWJTYND-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClO2
Molecular weight174.62 g/mol
IUPAC name2-chloro-5-methylcyclohexene-1-carboxylic acid
InChIKeyXXIXGILTWJTYND-UHFFFAOYSA-N
SMILESCC1CCC(=C(C1)C(=O)O)Cl

Computed by PubChem (NCBI)