CAS 90004-05-0 is the registry number for 2-(1,3,4-Oxadiazol-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(1,3,4-oxadiazol-2-yl)aniline (CAS 90004-05-0) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 2-(1,3,4-oxadiazol-2-yl)aniline. InChIKey: UXBNRVLITCYWTQ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-(1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | UXBNRVLITCYWTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=CO2)N |
Computed by PubChem (NCBI)