CAS 90005-55-3 appears in our catalog under these names: 3'–Amino–2'–hydroxyacetophenone hydrochloride, 3'-Amino-2'-hydroxyacetophenone HCl, 3'-Amino-2'-hydroxyacetophenone hydrochloride 98%, 3'-Amino-2'-hydroxyacetophenone hydrochloride, 98%, 3'-Amino-2'-hydroxyacetophenone Hydrochloride, >95% (HPLC). Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, TRC. Available pack sizes: 25g, 0,005kg, 0,002kg, 0,01kg, 0,025kg, 0,05kg, 100g, 500g.
1-(3-amino-2-hydroxyphenyl)ethanone;hydrochloride (CAS 90005-55-3) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 1-(3-amino-2-hydroxyphenyl)ethanone;hydrochloride. InChIKey: BSWMUKIPTBQFPN-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 1-(3-amino-2-hydroxyphenyl)ethanone;hydrochloride |
| InChIKey | BSWMUKIPTBQFPN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC=C1)N)O.Cl |
Computed by PubChem (NCBI)