CAS 90007-09-3 is the registry number for Pazopanib Impurity 25. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-ethyl-3-nitroaniline (CAS 90007-09-3) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-ethyl-3-nitroaniline. InChIKey: GOXSYEWCNIVDKU-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-ethyl-3-nitroaniline |
| InChIKey | GOXSYEWCNIVDKU-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)