Products 900784-30-7
CAS 900784-30-7 is the registry number for Antibacterial agent 108. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (3R,4S)-4-hydroxy-2-methylidene-3-naphthalen-1-yl-4-phenylbutanoate (CAS 900784-30-7) is a chemical compound with the molecular formula C22H20O3 and a molecular weight of 332.4 g/mol. IUPAC name: methyl (3R,4S)-4-hydroxy-2-methylidene-3-naphthalen-1-yl-4-phenylbutanoate. InChIKey: MYMDLOPCWJWCKG-LEWJYISDSA-N.
| Molecular formula | C22H20O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | methyl (3R,4S)-4-hydroxy-2-methylidene-3-naphthalen-1-yl-4-phenylbutanoate |
| InChIKey | MYMDLOPCWJWCKG-LEWJYISDSA-N |
| SMILES | COC(=O)C(=C)[C@@H](C1=CC=CC2=CC=CC=C21)[C@@H](C3=CC=CC=C3)O |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 108, orb1982879