Products 902742-85-2
CAS 902742-85-2 is the registry number for 4-chloro-8-(trifluoromethyl)quinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-8-(trifluoromethyl)quinoline-2-carboxylic acid (CAS 902742-85-2) is a chemical compound with the molecular formula C11H5ClF3NO2 and a molecular weight of 275.61 g/mol. IUPAC name: 4-chloro-8-(trifluoromethyl)quinoline-2-carboxylic acid. InChIKey: CEBSHFAVPPWBBZ-UHFFFAOYSA-N.
| Molecular formula | C11H5ClF3NO2 |
|---|---|
| Molecular weight | 275.61 g/mol |
| IUPAC name | 4-chloro-8-(trifluoromethyl)quinoline-2-carboxylic acid |
| InChIKey | CEBSHFAVPPWBBZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(F)(F)F)N=C(C=C2Cl)C(=O)O |
Computed by PubChem (NCBI)