CAS 34520-60-0 is the registry number for 1-(2-Chloro-5-(trifluoromethyl)phenyl)-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[2-chloro-5-(trifluoromethyl)phenyl]pyrrole-2,5-dione (CAS 34520-60-0) is a chemical compound with the molecular formula C11H5ClF3NO2 and a molecular weight of 275.61 g/mol. IUPAC name: 1-[2-chloro-5-(trifluoromethyl)phenyl]pyrrole-2,5-dione. InChIKey: FOXJLKZHQDGHLK-UHFFFAOYSA-N.
| Molecular formula | C11H5ClF3NO2 |
|---|---|
| Molecular weight | 275.61 g/mol |
| IUPAC name | 1-[2-chloro-5-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| InChIKey | FOXJLKZHQDGHLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N2C(=O)C=CC2=O)Cl |
Computed by PubChem (NCBI)