Products 168834-32-0
CAS 168834-32-0 is the registry number for 6-Chloro-4-ethynyl-1,4-dihydro-4-(trifluoromethyl)-2H-3,1-benzoxazin-2-one. Offered by: TRC. Available pack sizes: 50mg.
6-chloro-4-ethynyl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 168834-32-0) is a chemical compound with the molecular formula C11H5ClF3NO2 and a molecular weight of 275.61 g/mol. IUPAC name: 6-chloro-4-ethynyl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: QKFXVPYWSZJIMC-UHFFFAOYSA-N.
| Molecular formula | C11H5ClF3NO2 |
|---|---|
| Molecular weight | 275.61 g/mol |
| IUPAC name | 6-chloro-4-ethynyl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | QKFXVPYWSZJIMC-UHFFFAOYSA-N |
| SMILES | C#CC1(C2=C(C=CC(=C2)Cl)NC(=O)O1)C(F)(F)F |
Computed by PubChem (NCBI)