Products 90321-33-8

CAS 90321-33-8 is the registry number for 2-Amino-4,6-dimethylbenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-amino-4,6-dimethylbenzoic acid (CAS 90321-33-8) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 2-amino-4,6-dimethylbenzoic acid. InChIKey: AQVKFJZUSUMLPL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2
Molecular weight165.19 g/mol
IUPAC name2-amino-4,6-dimethylbenzoic acid
InChIKeyAQVKFJZUSUMLPL-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)N)C(=O)O)C

Computed by PubChem (NCBI)