CAS 90321-33-8 is the registry number for 2-Amino-4,6-dimethylbenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-4,6-dimethylbenzoic acid (CAS 90321-33-8) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 2-amino-4,6-dimethylbenzoic acid. InChIKey: AQVKFJZUSUMLPL-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 2-amino-4,6-dimethylbenzoic acid |
| InChIKey | AQVKFJZUSUMLPL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)N)C(=O)O)C |
Computed by PubChem (NCBI)