Products 903296-16-2
CAS 903296-16-2 is the registry number for 2-Indol-3-yl-2-oxo-N-(4-phenoxyphenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg, 5000mg, 2000mg.
2-(1H-indol-3-yl)-2-oxo-N-(4-phenoxyphenyl)acetamide (CAS 903296-16-2) is a chemical compound with the molecular formula C22H16N2O3 and a molecular weight of 356.4 g/mol. IUPAC name: 2-(1H-indol-3-yl)-2-oxo-N-(4-phenoxyphenyl)acetamide. InChIKey: QTVXPBLGVXFEIU-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O3 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-2-oxo-N-(4-phenoxyphenyl)acetamide |
| InChIKey | QTVXPBLGVXFEIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)NC(=O)C(=O)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)