CAS 904815-05-0 appears in our catalog under these names: 4-Fluoro-1,2-benzoxazol-3-amine, 97%, 4-Fluorobenzo(d)isoxazol-3-amine, 97%, 4–Fluoro–1,2–benzisoxazol–3–aMine, 4-Fluoro-1,2-benzoxazol-3-amine, 4-Fluorobenzo[d]isoxazol-3-amine 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg, 2,5g.
4-fluoro-1,2-benzoxazol-3-amine (CAS 904815-05-0) is a chemical compound with the molecular formula C7H5FN2O and a molecular weight of 152.13 g/mol. IUPAC name: 4-fluoro-1,2-benzoxazol-3-amine. InChIKey: YYCPEUWXNKDHQE-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O |
|---|---|
| Molecular weight | 152.13 g/mol |
| IUPAC name | 4-fluoro-1,2-benzoxazol-3-amine |
| InChIKey | YYCPEUWXNKDHQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=NO2)N |
Computed by PubChem (NCBI)