CAS 905274-02-4 is the registry number for (Z)-tert-Butyl 3-((dimethylamino)methylene)-4-oxopyrrolidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
Tert-butyl (3Z)-3-(dimethylaminomethylidene)-4-oxopyrrolidine-1-carboxylate (CAS 905274-02-4) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl (3Z)-3-(dimethylaminomethylidene)-4-oxopyrrolidine-1-carboxylate. InChIKey: NICVZJAVRBPUME-TWGQIWQCSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl (3Z)-3-(dimethylaminomethylidene)-4-oxopyrrolidine-1-carboxylate |
| InChIKey | NICVZJAVRBPUME-TWGQIWQCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C/C(=C/N(C)C)/C(=O)C1 |
Computed by PubChem (NCBI)