Products 905311-56-0
CAS 905311-56-0 is the registry number for (4-Amino-1H-imidazol-5-yl)(phenyl)methanone, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4-amino-1H-imidazol-5-yl)-phenylmethanone (CAS 905311-56-0) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: (4-amino-1H-imidazol-5-yl)-phenylmethanone. InChIKey: GAEJFSSGNUZDID-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | (4-amino-1H-imidazol-5-yl)-phenylmethanone |
| InChIKey | GAEJFSSGNUZDID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(N=CN2)N |
Computed by PubChem (NCBI)