CAS 90536-63-3 is the registry number for 2,4-Dihydroxy-3,5-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dihydroxy-3,5-dimethylbenzoic acid (CAS 90536-63-3) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 2,4-dihydroxy-3,5-dimethylbenzoic acid. InChIKey: DGSVFCYEUDKSOR-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 2,4-dihydroxy-3,5-dimethylbenzoic acid |
| InChIKey | DGSVFCYEUDKSOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1O)C)O)C(=O)O |
Computed by PubChem (NCBI)