Products 90536-63-3

CAS 90536-63-3 is the registry number for 2,4-Dihydroxy-3,5-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,4-dihydroxy-3,5-dimethylbenzoic acid (CAS 90536-63-3) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 2,4-dihydroxy-3,5-dimethylbenzoic acid. InChIKey: DGSVFCYEUDKSOR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O4
Molecular weight182.17 g/mol
IUPAC name2,4-dihydroxy-3,5-dimethylbenzoic acid
InChIKeyDGSVFCYEUDKSOR-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1O)C)O)C(=O)O

Computed by PubChem (NCBI)