Products 905823-30-5

CAS 905823-30-5 is the registry number for Trans-3-(benzyloxy)cyclobutanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-phenylmethoxycyclobutan-1-amine;hydrochloride (CAS 905823-30-5) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-phenylmethoxycyclobutan-1-amine;hydrochloride. InChIKey: AJMLIIBGYIRLDD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO
Molecular weight213.70 g/mol
IUPAC name3-phenylmethoxycyclobutan-1-amine;hydrochloride
InChIKeyAJMLIIBGYIRLDD-UHFFFAOYSA-N
SMILESC1C(CC1OCC2=CC=CC=C2)N.Cl

Computed by PubChem (NCBI)