Products 90606-77-2

CAS 90606-77-2 is the registry number for Tert-Butyl 5',6'-Dihydro-[2,4'-Bipyridine]-1'(2'H)-Carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-pyridin-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 90606-77-2) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl 4-pyridin-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: KKKDSTYVFRNJIN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20N2O2
Molecular weight260.33 g/mol
IUPAC nametert-butyl 4-pyridin-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate
InChIKeyKKKDSTYVFRNJIN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(=CC1)C2=CC=CC=N2

Computed by PubChem (NCBI)