CAS 906366-50-5 is the registry number for Dibenzyl-D-serine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(dibenzylamino)-3-hydroxypropanoic acid (CAS 906366-50-5) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: (2R)-2-(dibenzylamino)-3-hydroxypropanoic acid. InChIKey: IAVOOHAFSZKXIS-MRXNPFEDSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | (2R)-2-(dibenzylamino)-3-hydroxypropanoic acid |
| InChIKey | IAVOOHAFSZKXIS-MRXNPFEDSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)[C@H](CO)C(=O)O |
Computed by PubChem (NCBI)