Products 90647-79-3

CAS 90647-79-3 appears in our catalog under these names: 2,2-Diethyl-4-methoxy-4-oxobutanoic acid, 95%, 2,2-Diethyl-4-methoxy-4-oxobutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,2-diethyl-4-methoxy-4-oxobutanoic acid (CAS 90647-79-3) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: 2,2-diethyl-4-methoxy-4-oxobutanoic acid. InChIKey: OMSRLYFMMRURIV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O4
Molecular weight188.22 g/mol
IUPAC name2,2-diethyl-4-methoxy-4-oxobutanoic acid
InChIKeyOMSRLYFMMRURIV-UHFFFAOYSA-N
SMILESCCC(CC)(CC(=O)OC)C(=O)O

Computed by PubChem (NCBI)