CAS 906673-30-1 appears in our catalog under these names: Crisaborole o-Isomer, Crisaborole Impurity 5, Crisaborole Impurity 24, 4-Descyano-2-cyano-crisaborole. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile (CAS 906673-30-1) is a chemical compound with the molecular formula C14H10BNO3 and a molecular weight of 251.05 g/mol. IUPAC name: 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile. InChIKey: GWZBDMXSRRGGLN-UHFFFAOYSA-N.
| Molecular formula | C14H10BNO3 |
|---|---|
| Molecular weight | 251.05 g/mol |
| IUPAC name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile |
| InChIKey | GWZBDMXSRRGGLN-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)OC3=CC=CC=C3C#N)O |
Computed by PubChem (NCBI)