Products 907607-58-3
CAS 907607-58-3 appears in our catalog under these names: 9α–Hydroxysophocarpine, 9α-Hydroxysophocarpine. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(1R,2R,9S,15S,17S)-15-hydroxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one (CAS 907607-58-3) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: (1R,2R,9S,15S,17S)-15-hydroxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one. InChIKey: HAPHBHKQJIPUEP-WHPHWUKISA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | (1R,2R,9S,15S,17S)-15-hydroxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one |
| InChIKey | HAPHBHKQJIPUEP-WHPHWUKISA-N |
| SMILES | C1C[C@H]2CN3[C@H](CC=CC3=O)[C@@H]4[C@H]2N(C1)C[C@H](C4)O |
Computed by PubChem (NCBI)