CAS 90794-16-4 appears in our catalog under these names: 2-(4-Fluorophenyl)butanoic acid, 2-(4-Fluorophenyl)butanoic acid, 97%, 2-(4-Fluorophenyl)butanoic acid, 97%, 97%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2-(4-fluorophenyl)butanoic acid (CAS 90794-16-4) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 2-(4-fluorophenyl)butanoic acid. InChIKey: KQKOJJNAHZCQRX-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 2-(4-fluorophenyl)butanoic acid |
| InChIKey | KQKOJJNAHZCQRX-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)