Products 908247-29-0
CAS 908247-29-0 appears in our catalog under these names: 4-(2-Cyclopropylethynyl)benzoic acid, 95-<97%, 4–(Cyclopropylethynyl)benzoic acid, 4-(2-Cyclopropylethynyl)benzoic Acid, 4-(Cyclopropylethynyl)benzoic acid 95%, 4-(Cyclopropylethynyl)benzoic acid, 95%, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 100mg, 250mg, 1g.
4-(2-cyclopropylethynyl)benzoic acid (CAS 908247-29-0) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 4-(2-cyclopropylethynyl)benzoic acid. InChIKey: QVHNCHIMHYMBHR-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 4-(2-cyclopropylethynyl)benzoic acid |
| InChIKey | QVHNCHIMHYMBHR-UHFFFAOYSA-N |
| SMILES | C1CC1C#CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)