Products 908494-47-3
CAS 908494-47-3 is the registry number for 3-Chloro-n-2,3-dihydro-1h-inden-5-ylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide (CAS 908494-47-3) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide. InChIKey: QJMWYGURKXRWFW-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
| InChIKey | QJMWYGURKXRWFW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NC(=O)CCCl |
Computed by PubChem (NCBI)