CAS 915781-01-0 is the registry number for 1-(1-Amino-ethyl)-naphthalen-2-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
1-(1-aminoethyl)naphthalen-2-ol;hydrochloride (CAS 915781-01-0) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 1-(1-aminoethyl)naphthalen-2-ol;hydrochloride. InChIKey: PCHNWTHRLGSSBN-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 1-(1-aminoethyl)naphthalen-2-ol;hydrochloride |
| InChIKey | PCHNWTHRLGSSBN-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC2=CC=CC=C21)O)N.Cl |
Computed by PubChem (NCBI)