Products 908578-43-8

CAS 908578-43-8 is the registry number for 2-Ethanesulfonamidopropanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(ethylsulfonylamino)propanoic acid (CAS 908578-43-8) is a chemical compound with the molecular formula C5H11NO4S and a molecular weight of 181.21 g/mol. IUPAC name: 2-(ethylsulfonylamino)propanoic acid. InChIKey: GAUFCGISNUXEDT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H11NO4S
Molecular weight181.21 g/mol
IUPAC name2-(ethylsulfonylamino)propanoic acid
InChIKeyGAUFCGISNUXEDT-UHFFFAOYSA-N
SMILESCCS(=O)(=O)NC(C)C(=O)O

Computed by PubChem (NCBI)