Products 90870-78-3
CAS 90870-78-3 is the registry number for 2-(5-Amino-3-(pyridin-3-yl)-1H-pyrazol-1-yl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-amino-3-pyridin-3-ylpyrazol-1-yl)ethanol (CAS 90870-78-3) is a chemical compound with the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. IUPAC name: 2-(5-amino-3-pyridin-3-ylpyrazol-1-yl)ethanol. InChIKey: GCNWFLWRPSHSBN-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 2-(5-amino-3-pyridin-3-ylpyrazol-1-yl)ethanol |
| InChIKey | GCNWFLWRPSHSBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NN(C(=C2)N)CCO |
Computed by PubChem (NCBI)