CAS 908846-99-1 appears in our catalog under these names: Fmoc-Trp(6-Me)-OH 95%, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-6-methyl-L-tryptophan, 95%, 95%, N-Fmoc-6-methyl-L-tryptophan, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-methyl-1H-indol-3-yl)propanoic acid (CAS 908846-99-1) is a chemical compound with the molecular formula C27H24N2O4 and a molecular weight of 440.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-methyl-1H-indol-3-yl)propanoic acid. InChIKey: AZYYHRQGDYITPE-VWLOTQADSA-N.
| Molecular formula | C27H24N2O4 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | AZYYHRQGDYITPE-VWLOTQADSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)