Products 908856-66-6
CAS 908856-66-6 is the registry number for 5-Cyclohexyl-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-cyclohexyl-1,2-oxazole-3-carboxylic acid (CAS 908856-66-6) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 5-cyclohexyl-1,2-oxazole-3-carboxylic acid. InChIKey: MUPJTIPMJXOUGX-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 5-cyclohexyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | MUPJTIPMJXOUGX-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)