CAS 909103-56-6 appears in our catalog under these names: 3,3'-(1,4-Phenylenebis(ethyne-2,1-diyl))dibenzaldehyde, 95%, 3,3'-(1,4-Phenylenebis(ethyne-2,1-diyl))dibenzaldehyde, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
3-[2-[4-[2-(3-formylphenyl)ethynyl]phenyl]ethynyl]benzaldehyde (CAS 909103-56-6) is a chemical compound with the molecular formula C24H14O2 and a molecular weight of 334.4 g/mol. IUPAC name: 3-[2-[4-[2-(3-formylphenyl)ethynyl]phenyl]ethynyl]benzaldehyde. InChIKey: OLWVKGWJCRVJLM-UHFFFAOYSA-N.
| Molecular formula | C24H14O2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 3-[2-[4-[2-(3-formylphenyl)ethynyl]phenyl]ethynyl]benzaldehyde |
| InChIKey | OLWVKGWJCRVJLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#CC2=CC=C(C=C2)C#CC3=CC=CC(=C3)C=O)C=O |
Computed by PubChem (NCBI)