CAS 97094-35-4 is the registry number for 2,5-Bis(phenylethynyl)terephthalaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-bis(2-phenylethynyl)terephthalaldehyde (CAS 97094-35-4) is a chemical compound with the molecular formula C24H14O2 and a molecular weight of 334.4 g/mol. IUPAC name: 2,5-bis(2-phenylethynyl)terephthalaldehyde. InChIKey: XAZOZVDBSUJQQF-UHFFFAOYSA-N.
| Molecular formula | C24H14O2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2,5-bis(2-phenylethynyl)terephthalaldehyde |
| InChIKey | XAZOZVDBSUJQQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=C(C=C2C=O)C#CC3=CC=CC=C3)C=O |
Computed by PubChem (NCBI)