Products 909527-68-0
CAS 909527-68-0 is the registry number for ethyl 3-((2,4-dimethylphenyl)amino)-2-nitriloprop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (Z)-2-cyano-3-(2,4-dimethylanilino)prop-2-enoate (CAS 909527-68-0) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: ethyl (Z)-2-cyano-3-(2,4-dimethylanilino)prop-2-enoate. InChIKey: CAFDCQQDUNURMM-XFXZXTDPSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | ethyl (Z)-2-cyano-3-(2,4-dimethylanilino)prop-2-enoate |
| InChIKey | CAFDCQQDUNURMM-XFXZXTDPSA-N |
| SMILES | CCOC(=O)/C(=C\NC1=C(C=C(C=C1)C)C)/C#N |
Computed by PubChem (NCBI)