Products 90965-68-7
CAS 90965-68-7 appears in our catalog under these names: Butylphthalide Impurity 24, Butylphthalide Impurity 13. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3Z)-3-pentylidene-2-benzofuran-1-one (CAS 90965-68-7) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: (3Z)-3-pentylidene-2-benzofuran-1-one. InChIKey: UYKZUWVXNVHOGQ-XFXZXTDPSA-N.
| Molecular formula | C13H14O2 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (3Z)-3-pentylidene-2-benzofuran-1-one |
| InChIKey | UYKZUWVXNVHOGQ-XFXZXTDPSA-N |
| SMILES | CCCC/C=C\1/C2=CC=CC=C2C(=O)O1 |
Computed by PubChem (NCBI)